About 6-phenylthieno[3,2-b]thiophene
6-phenylthieno[3,2-b]thiophene (PubChem CID 91665235) has the molecular formula C12H8S2
and a molecular weight of 216.33 g/mol. Its IUPAC name is 6-phenylthieno[3,2-b]thiophene.
Molecular Properties
| Compound Name | 6-phenylthieno[3,2-b]thiophene |
| PubChem CID | 91665235 |
| Molecular Formula | C12H8S2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 6-phenylthieno[3,2-b]thiophene |
| SMILES | c1ccc(-c2csc3ccsc23)cc1 |
| InChI | InChI=1S/C12H8S2/c1-2-4-9(5-3-1)10-8-14-11-6-7-13-12(10)11/h1-8H |
| InChIKey | NUMJORFGVQWINX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-phenylthieno[3,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenylthieno[3,2-b]thiophene?
The IUPAC name of 6-phenylthieno[3,2-b]thiophene (CID 91665235) is 6-phenylthieno[3,2-b]thiophene.
What is the SMILES notation for 6-phenylthieno[3,2-b]thiophene?
The canonical SMILES for 6-phenylthieno[3,2-b]thiophene is c1ccc(-c2csc3ccsc23)cc1.
What is the InChIKey of 6-phenylthieno[3,2-b]thiophene?
The InChIKey is NUMJORFGVQWINX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8S2/c1-2-4-9(5-3-1)10-8-14-11-6-7-13-12(10)11/h1-8H.
What are the key properties of 6-phenylthieno[3,2-b]thiophene?
6-phenylthieno[3,2-b]thiophene has a molecular weight of 216.33 g/mol, XLogP of 4.63, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenylthieno[3,2-b]thiophene is sourced from PubChem (CID 91665235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).