C14H10N2O — CID 12992200
3-phenyl-1H-1,5-naphthyridin-2-one (PubChem CID 12992200) has the molecular formula C14H10N2O and a molecular weight of 222.25 g/mol. Its IUPAC name is 3-phenyl-1H-1,5-naphthyridin-2-one.
| Compound Name | 3-phenyl-1H-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 12992200 |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 3-phenyl-1H-1,5-naphthyridin-2-one |
| SMILES | O=c1[nH]c2cccnc2cc1-c1ccccc1 |
| InChI | InChI=1S/C14H10N2O/c17-14-11(10-5-2-1-3-6-10)9-13-12(16-14)7-4-8-15-13/h1-9H,(H,16,17) |
| InChIKey | QHFHAVYJMVLRNJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |