About 2-chloro-3-phenyl-1,5-naphthyridine
2-chloro-3-phenyl-1,5-naphthyridine (PubChem CID 59380854) has the molecular formula C14H9ClN2
and a molecular weight of 240.69 g/mol. Its IUPAC name is 2-chloro-3-phenyl-1,5-naphthyridine.
Molecular Properties
| Compound Name | 2-chloro-3-phenyl-1,5-naphthyridine |
| PubChem CID | 59380854 |
| Molecular Formula | C14H9ClN2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-chloro-3-phenyl-1,5-naphthyridine |
| SMILES | Clc1nc2cccnc2cc1-c1ccccc1 |
| InChI | InChI=1S/C14H9ClN2/c15-14-11(10-5-2-1-3-6-10)9-13-12(17-14)7-4-8-16-13/h1-9H |
| InChIKey | UMOPUYJFLXEFEY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-phenyl-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-phenyl-1,5-naphthyridine?
The IUPAC name of 2-chloro-3-phenyl-1,5-naphthyridine (CID 59380854) is 2-chloro-3-phenyl-1,5-naphthyridine.
What is the SMILES notation for 2-chloro-3-phenyl-1,5-naphthyridine?
The canonical SMILES for 2-chloro-3-phenyl-1,5-naphthyridine is Clc1nc2cccnc2cc1-c1ccccc1.
What is the InChIKey of 2-chloro-3-phenyl-1,5-naphthyridine?
The InChIKey is UMOPUYJFLXEFEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClN2/c15-14-11(10-5-2-1-3-6-10)9-13-12(17-14)7-4-8-16-13/h1-9H.
What are the key properties of 2-chloro-3-phenyl-1,5-naphthyridine?
2-chloro-3-phenyl-1,5-naphthyridine has a molecular weight of 240.69 g/mol, XLogP of 3.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-phenyl-1,5-naphthyridine is sourced from PubChem (CID 59380854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).