C8H4Cl2N2 — CID 13122786
2,3-dichloro-1,5-naphthyridine (PubChem CID 13122786) has the molecular formula C8H4Cl2N2 and a molecular weight of 199.04 g/mol. Its IUPAC name is 2,3-dichloro-1,5-naphthyridine.
| Compound Name | 2,3-dichloro-1,5-naphthyridine |
|---|---|
| PubChem CID | 13122786 |
| Molecular Formula | C8H4Cl2N2 |
| Molecular Weight | 199.04 g/mol |
| Exact Mass | 197.98 |
| IUPAC Name | 2,3-dichloro-1,5-naphthyridine |
| SMILES | Clc1cc2ncccc2nc1Cl |
| InChI | InChI=1S/C8H4Cl2N2/c9-5-4-7-6(12-8(5)10)2-1-3-11-7/h1-4H |
| InChIKey | ZDSOWHAAHXDGMD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.04 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|