About 2,3-dichloroquinoline;toluene
2,3-dichloroquinoline;toluene (PubChem CID 174855032) has the molecular formula C16H13Cl2N
and a molecular weight of 290.19 g/mol. Its IUPAC name is 2,3-dichloroquinoline;toluene.
Molecular Properties
| Compound Name | 2,3-dichloroquinoline;toluene |
| PubChem CID | 174855032 |
| Molecular Formula | C16H13Cl2N |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 2,3-dichloroquinoline;toluene |
| SMILES | Cc1ccccc1.Clc1cc2ccccc2nc1Cl |
| InChI | InChI=1S/C9H5Cl2N.C7H8/c10-7-5-6-3-1-2-4-8(6)12-9(7)11;1-7-5-3-2-4-6-7/h1-5H;2-6H,1H3 |
| InChIKey | PIPBKVGTGVWGBA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dichloroquinoline;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dichloroquinoline;toluene?
The IUPAC name of 2,3-dichloroquinoline;toluene (CID 174855032) is 2,3-dichloroquinoline;toluene.
What is the SMILES notation for 2,3-dichloroquinoline;toluene?
The canonical SMILES for 2,3-dichloroquinoline;toluene is Cc1ccccc1.Clc1cc2ccccc2nc1Cl.
What is the InChIKey of 2,3-dichloroquinoline;toluene?
The InChIKey is PIPBKVGTGVWGBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Cl2N.C7H8/c10-7-5-6-3-1-2-4-8(6)12-9(7)11;1-7-5-3-2-4-6-7/h1-5H;2-6H,1H3.
What are the key properties of 2,3-dichloroquinoline;toluene?
2,3-dichloroquinoline;toluene has a molecular weight of 290.19 g/mol, XLogP of 5.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichloroquinoline;toluene is sourced from PubChem (CID 174855032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).