About CID 59355459
CID 59355459 (PubChem CID 59355459) has the molecular formula C10H6N2
and a molecular weight of 154.17 g/mol.
Molecular Properties
| Compound Name | CID 59355459 |
| PubChem CID | 59355459 |
| Molecular Formula | C10H6N2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | — |
| SMILES | [CH]c1cc2ncccc2nc1[CH] |
| InChI | InChI=1S/C10H6N2/c1-7-6-10-9(12-8(7)2)4-3-5-11-10/h1-6H |
| InChIKey | BLGORKKUBQLEOR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 59355459 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59355459?
The IUPAC name of CID 59355459 (CID 59355459) is not available.
What is the SMILES notation for CID 59355459?
The canonical SMILES for CID 59355459 is [CH]c1cc2ncccc2nc1[CH].
What is the InChIKey of CID 59355459?
The InChIKey is BLGORKKUBQLEOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2/c1-7-6-10-9(12-8(7)2)4-3-5-11-10/h1-6H.
What are the key properties of CID 59355459?
CID 59355459 has a molecular weight of 154.17 g/mol, XLogP of 1.75, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59355459 is sourced from PubChem (CID 59355459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).