About 3-(4,5-diphenylthiophen-2-yl)-1H-quinoxalin-2-one
3-(4,5-diphenylthiophen-2-yl)-1H-quinoxalin-2-one (PubChem CID 2276415) has the molecular formula C24H16N2OS
and a molecular weight of 380.47 g/mol. Its IUPAC name is 3-(4,5-diphenylthiophen-2-yl)-1H-quinoxalin-2-one.
Molecular Properties
| Compound Name | 3-(4,5-diphenylthiophen-2-yl)-1H-quinoxalin-2-one |
| PubChem CID | 2276415 |
| Molecular Formula | C24H16N2OS |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 3-(4,5-diphenylthiophen-2-yl)-1H-quinoxalin-2-one |
| SMILES | O=c1[nH]c2ccccc2nc1-c1cc(-c2ccccc2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C24H16N2OS/c27-24-22(25-19-13-7-8-14-20(19)26-24)21-15-18(16-9-3-1-4-10-16)23(28-21)17-11-5-2-6-12-17/h1-15H,(H,26,27) |
| InChIKey | FQFUBGYYMSJEAE-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4,5-diphenylthiophen-2-yl)-1H-quinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-diphenylthiophen-2-yl)-1H-quinoxalin-2-one?
The IUPAC name of 3-(4,5-diphenylthiophen-2-yl)-1H-quinoxalin-2-one (CID 2276415) is 3-(4,5-diphenylthiophen-2-yl)-1H-quinoxalin-2-one.
What is the SMILES notation for 3-(4,5-diphenylthiophen-2-yl)-1H-quinoxalin-2-one?
The canonical SMILES for 3-(4,5-diphenylthiophen-2-yl)-1H-quinoxalin-2-one is O=c1[nH]c2ccccc2nc1-c1cc(-c2ccccc2)c(-c2ccccc2)s1.
What is the InChIKey of 3-(4,5-diphenylthiophen-2-yl)-1H-quinoxalin-2-one?
The InChIKey is FQFUBGYYMSJEAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16N2OS/c27-24-22(25-19-13-7-8-14-20(19)26-24)21-15-18(16-9-3-1-4-10-16)23(28-21)17-11-5-2-6-12-17/h1-15H,(H,26,27).
What are the key properties of 3-(4,5-diphenylthiophen-2-yl)-1H-quinoxalin-2-one?
3-(4,5-diphenylthiophen-2-yl)-1H-quinoxalin-2-one has a molecular weight of 380.47 g/mol, XLogP of 5.99, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-diphenylthiophen-2-yl)-1H-quinoxalin-2-one is sourced from PubChem (CID 2276415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).