C7H6N2O2S — CID 172829313
1H-pyrrolo[3,2-b]pyridine-2-sulfinic acid (PubChem CID 172829313) has the molecular formula C7H6N2O2S and a molecular weight of 182.20 g/mol. Its IUPAC name is 1H-pyrrolo[3,2-b]pyridine-2-sulfinic acid.
| Compound Name | 1H-pyrrolo[3,2-b]pyridine-2-sulfinic acid |
|---|---|
| PubChem CID | 172829313 |
| Molecular Formula | C7H6N2O2S |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | 1H-pyrrolo[3,2-b]pyridine-2-sulfinic acid |
| SMILES | O=S(O)c1cc2ncccc2[nH]1 |
| InChI | InChI=1S/C7H6N2O2S/c10-12(11)7-4-6-5(9-7)2-1-3-8-6/h1-4,9H,(H,10,11) |
| InChIKey | VHMXPJRZBOKPSF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|