C11H14N2O2 — CID 170754494
methoxyethane;1H-pyrrolo[3,2-b]pyridine-2-carbaldehyde (PubChem CID 170754494) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is methoxyethane;1H-pyrrolo[3,2-b]pyridine-2-carbaldehyde.
| Compound Name | methoxyethane;1H-pyrrolo[3,2-b]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 170754494 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | methoxyethane;1H-pyrrolo[3,2-b]pyridine-2-carbaldehyde |
| SMILES | CCOC.O=Cc1cc2ncccc2[nH]1 |
| InChI | InChI=1S/C8H6N2O.C3H8O/c11-5-6-4-8-7(10-6)2-1-3-9-8;1-3-4-2/h1-5,10H;3H2,1-2H3 |
| InChIKey | LISNYEZTQWAFQC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|