C14H14FN3O2 — CID 154681865
2-benzyl-4H-pyrrolo[3,2-c]pyrazole-5-carbaldehyde;methyl hypofluorite (PubChem CID 154681865) has the molecular formula C14H14FN3O2 and a molecular weight of 275.28 g/mol. Its IUPAC name is 2-benzyl-4H-pyrrolo[3,2-c]pyrazole-5-carbaldehyde;methyl hypofluorite.
| Compound Name | 2-benzyl-4H-pyrrolo[3,2-c]pyrazole-5-carbaldehyde;methyl hypofluorite |
|---|---|
| PubChem CID | 154681865 |
| Molecular Formula | C14H14FN3O2 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-benzyl-4H-pyrrolo[3,2-c]pyrazole-5-carbaldehyde;methyl hypofluorite |
| SMILES | COF.O=Cc1cc2nn(Cc3ccccc3)cc2[nH]1 |
| InChI | InChI=1S/C13H11N3O.CH3FO/c17-9-11-6-12-13(14-11)8-16(15-12)7-10-4-2-1-3-5-10;1-3-2/h1-6,8-9,14H,7H2;1H3 |
| InChIKey | JCQFFWGVBLVAKZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|