C19H16N2O3 — CID 19619706
methyl 3-[(4-formyl-3-phenylpyrazol-1-yl)methyl]benzoate (PubChem CID 19619706) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is methyl 3-[(4-formyl-3-phenylpyrazol-1-yl)methyl]benzoate.
| Compound Name | methyl 3-[(4-formyl-3-phenylpyrazol-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 19619706 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | methyl 3-[(4-formyl-3-phenylpyrazol-1-yl)methyl]benzoate |
| SMILES | COC(=O)c1cccc(Cn2cc(C=O)c(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C19H16N2O3/c1-24-19(23)16-9-5-6-14(10-16)11-21-12-17(13-22)18(20-21)15-7-3-2-4-8-15/h2-10,12-13H,11H2,1H3 |
| InChIKey | IYNBVUOJIOHYMY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|