C12H9N2O3- — CID 4195588
2-(4-formyl-3-phenylpyrazol-1-yl)acetate (PubChem CID 4195588) has the molecular formula C12H9N2O3- and a molecular weight of 229.22 g/mol. Its IUPAC name is 2-(4-formyl-3-phenylpyrazol-1-yl)acetate.
| Compound Name | 2-(4-formyl-3-phenylpyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 4195588 |
| Molecular Formula | C12H9N2O3- |
| Molecular Weight | 229.22 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 2-(4-formyl-3-phenylpyrazol-1-yl)acetate |
| SMILES | O=Cc1cn(CC(=O)[O-])nc1-c1ccccc1 |
| InChI | InChI=1S/C12H10N2O3/c15-8-10-6-14(7-11(16)17)13-12(10)9-4-2-1-3-5-9/h1-6,8H,7H2,(H,16,17)/p-1 |
| InChIKey | ISHHGFBHHJLDAV-UHFFFAOYSA-M |
| XLogP | 0.11 |
| TPSA | 75.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|