C13H10BrN2O3- — CID 2369286
3-[3-(4-bromophenyl)-4-formylpyrazol-1-yl]propanoate (PubChem CID 2369286) has the molecular formula C13H10BrN2O3- and a molecular weight of 322.14 g/mol. Its IUPAC name is 3-[3-(4-bromophenyl)-4-formylpyrazol-1-yl]propanoate.
| Compound Name | 3-[3-(4-bromophenyl)-4-formylpyrazol-1-yl]propanoate |
|---|---|
| PubChem CID | 2369286 |
| Molecular Formula | C13H10BrN2O3- |
| Molecular Weight | 322.14 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | 3-[3-(4-bromophenyl)-4-formylpyrazol-1-yl]propanoate |
| SMILES | O=Cc1cn(CCC(=O)[O-])nc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H11BrN2O3/c14-11-3-1-9(2-4-11)13-10(8-17)7-16(15-13)6-5-12(18)19/h1-4,7-8H,5-6H2,(H,18,19)/p-1 |
| InChIKey | GAYHFUFXEAVPAX-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 75.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.14 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|