C18H15ClN3O4- — CID 2389783
3-[3-(4-chlorophenyl)-4-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]pyrazol-1-yl]propanoate (PubChem CID 2389783) has the molecular formula C18H15ClN3O4- and a molecular weight of 372.79 g/mol. Its IUPAC name is 3-[3-(4-chlorophenyl)-4-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]pyrazol-1-yl]propanoate.
| Compound Name | 3-[3-(4-chlorophenyl)-4-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]pyrazol-1-yl]propanoate |
|---|---|
| PubChem CID | 2389783 |
| Molecular Formula | C18H15ClN3O4- |
| Molecular Weight | 372.79 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 3-[3-(4-chlorophenyl)-4-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]pyrazol-1-yl]propanoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1cn(CCC(=O)[O-])nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClN3O4/c1-2-26-18(25)13(10-20)9-14-11-22(8-7-16(23)24)21-17(14)12-3-5-15(19)6-4-12/h3-6,9,11H,2,7-8H2,1H3,(H,23,24)/p-1/b13-9+ |
| InChIKey | BLPCBPUSPPHAFU-UKTHLTGXSA-M |
| XLogP | 1.81 |
| TPSA | 108.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.79 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|