C20H20N3O6- — CID 7041409
3-[4-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)-3-(3,4-dimethoxyphenyl)pyrazol-1-yl]propanoate (PubChem CID 7041409) has the molecular formula C20H20N3O6- and a molecular weight of 398.40 g/mol. Its IUPAC name is 3-[4-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)-3-(3,4-dimethoxyphenyl)pyrazol-1-yl]propanoate.
| Compound Name | 3-[4-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)-3-(3,4-dimethoxyphenyl)pyrazol-1-yl]propanoate |
|---|---|
| PubChem CID | 7041409 |
| Molecular Formula | C20H20N3O6- |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 3-[4-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)-3-(3,4-dimethoxyphenyl)pyrazol-1-yl]propanoate |
| SMILES | CCOC(=O)C(C#N)=Cc1cn(CCC(=O)[O-])nc1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H21N3O6/c1-4-29-20(26)14(11-21)9-15-12-23(8-7-18(24)25)22-19(15)13-5-6-16(27-2)17(10-13)28-3/h5-6,9-10,12H,4,7-8H2,1-3H3,(H,24,25)/p-1 |
| InChIKey | MXUACKCJWHJOEM-UHFFFAOYSA-M |
| XLogP | 1.18 |
| TPSA | 126.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|