C18H17N4O5- — CID 2513247
(E)-3-[1-(3-amino-3-oxopropyl)-3-(3,4-dimethoxyphenyl)pyrazol-4-yl]-2-cyanoprop-2-enoate (PubChem CID 2513247) has the molecular formula C18H17N4O5- and a molecular weight of 369.36 g/mol. Its IUPAC name is (E)-3-[1-(3-amino-3-oxopropyl)-3-(3,4-dimethoxyphenyl)pyrazol-4-yl]-2-cyanoprop-2-enoate.
| Compound Name | (E)-3-[1-(3-amino-3-oxopropyl)-3-(3,4-dimethoxyphenyl)pyrazol-4-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 2513247 |
| Molecular Formula | C18H17N4O5- |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (E)-3-[1-(3-amino-3-oxopropyl)-3-(3,4-dimethoxyphenyl)pyrazol-4-yl]-2-cyanoprop-2-enoate |
| SMILES | COc1ccc(-c2nn(CCC(N)=O)cc2/C=C(\C#N)C(=O)[O-])cc1OC |
| InChI | InChI=1S/C18H18N4O5/c1-26-14-4-3-11(8-15(14)27-2)17-13(7-12(9-19)18(24)25)10-22(21-17)6-5-16(20)23/h3-4,7-8,10H,5-6H2,1-2H3,(H2,20,23)(H,24,25)/p-1/b12-7+ |
| InChIKey | JWTSCHAZXOZFLS-KPKJPENVSA-M |
| XLogP | 0.10 |
| TPSA | 143.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|