C16H12ClN4O3- — CID 2125381
(Z)-3-[1-(3-amino-3-oxopropyl)-3-(3-chlorophenyl)pyrazol-4-yl]-2-cyanoprop-2-enoate (PubChem CID 2125381) has the molecular formula C16H12ClN4O3- and a molecular weight of 343.75 g/mol. Its IUPAC name is (Z)-3-[1-(3-amino-3-oxopropyl)-3-(3-chlorophenyl)pyrazol-4-yl]-2-cyanoprop-2-enoate.
| Compound Name | (Z)-3-[1-(3-amino-3-oxopropyl)-3-(3-chlorophenyl)pyrazol-4-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 2125381 |
| Molecular Formula | C16H12ClN4O3- |
| Molecular Weight | 343.75 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | (Z)-3-[1-(3-amino-3-oxopropyl)-3-(3-chlorophenyl)pyrazol-4-yl]-2-cyanoprop-2-enoate |
| SMILES | N#C/C(=C/c1cn(CCC(N)=O)nc1-c1cccc(Cl)c1)C(=O)[O-] |
| InChI | InChI=1S/C16H13ClN4O3/c17-13-3-1-2-10(7-13)15-12(6-11(8-18)16(23)24)9-21(20-15)5-4-14(19)22/h1-3,6-7,9H,4-5H2,(H2,19,22)(H,23,24)/p-1/b11-6- |
| InChIKey | JXAJFCPFMYAKST-WDZFZDKYSA-M |
| XLogP | 0.74 |
| TPSA | 124.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.75 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|