C21H16BrFN2O3 — CID 3259275
3-[4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-3-(4-fluorophenyl)pyrazol-1-yl]propanoic acid (PubChem CID 3259275) has the molecular formula C21H16BrFN2O3 and a molecular weight of 443.27 g/mol. Its IUPAC name is 3-[4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-3-(4-fluorophenyl)pyrazol-1-yl]propanoic acid.
| Compound Name | 3-[4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-3-(4-fluorophenyl)pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 3259275 |
| Molecular Formula | C21H16BrFN2O3 |
| Molecular Weight | 443.27 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 3-[4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-3-(4-fluorophenyl)pyrazol-1-yl]propanoic acid |
| SMILES | O=C(O)CCn1cc(C=CC(=O)c2ccc(Br)cc2)c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H16BrFN2O3/c22-17-6-1-14(2-7-17)19(26)10-5-16-13-25(12-11-20(27)28)24-21(16)15-3-8-18(23)9-4-15/h1-10,13H,11-12H2,(H,27,28) |
| InChIKey | QAPZBLLRAYJVNP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.27 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|