C16H12N3O3S2- — CID 2387165
3-[4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-3-phenylpyrazol-1-yl]propanoate (PubChem CID 2387165) has the molecular formula C16H12N3O3S2- and a molecular weight of 358.42 g/mol. Its IUPAC name is 3-[4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-3-phenylpyrazol-1-yl]propanoate.
| Compound Name | 3-[4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-3-phenylpyrazol-1-yl]propanoate |
|---|---|
| PubChem CID | 2387165 |
| Molecular Formula | C16H12N3O3S2- |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 3-[4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-3-phenylpyrazol-1-yl]propanoate |
| SMILES | O=C([O-])CCn1cc(/C=C2\SC(=S)NC2=O)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H13N3O3S2/c20-13(21)6-7-19-9-11(8-12-15(22)17-16(23)24-12)14(18-19)10-4-2-1-3-5-10/h1-5,8-9H,6-7H2,(H,20,21)(H,17,22,23)/p-1/b12-8- |
| InChIKey | DQPAROZMMGNIBJ-WQLSENKSSA-M |
| XLogP | 1.18 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|