C18H12N3O4S2- — CID 2405659
3-[3-(1-benzofuran-2-yl)-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyrazol-1-yl]propanoate (PubChem CID 2405659) has the molecular formula C18H12N3O4S2- and a molecular weight of 398.45 g/mol. Its IUPAC name is 3-[3-(1-benzofuran-2-yl)-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyrazol-1-yl]propanoate.
| Compound Name | 3-[3-(1-benzofuran-2-yl)-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyrazol-1-yl]propanoate |
|---|---|
| PubChem CID | 2405659 |
| Molecular Formula | C18H12N3O4S2- |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 3-[3-(1-benzofuran-2-yl)-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyrazol-1-yl]propanoate |
| SMILES | O=C([O-])CCn1cc(/C=C2\SC(=S)NC2=O)c(-c2cc3ccccc3o2)n1 |
| InChI | InChI=1S/C18H13N3O4S2/c22-15(23)5-6-21-9-11(8-14-17(24)19-18(26)27-14)16(20-21)13-7-10-3-1-2-4-12(10)25-13/h1-4,7-9H,5-6H2,(H,22,23)(H,19,24,26)/p-1/b14-8- |
| InChIKey | KSKLRICEYNPTDT-ZSOIEALJSA-M |
| XLogP | 1.93 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|