C29H29N3O2S2 — CID 6513962
(5Z)-5-[[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]-3-(2-ethylhexyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6513962) has the molecular formula C29H29N3O2S2 and a molecular weight of 515.70 g/mol. Its IUPAC name is (5Z)-5-[[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]-3-(2-ethylhexyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]-3-(2-ethylhexyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6513962 |
| Molecular Formula | C29H29N3O2S2 |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | (5Z)-5-[[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]-3-(2-ethylhexyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCC(CC)CN1C(=O)/C(=C/c2cn(-c3ccccc3)nc2-c2cc3ccccc3o2)SC1=S |
| InChI | InChI=1S/C29H29N3O2S2/c1-3-5-11-20(4-2)18-31-28(33)26(36-29(31)35)17-22-19-32(23-13-7-6-8-14-23)30-27(22)25-16-21-12-9-10-15-24(21)34-25/h6-10,12-17,19-20H,3-5,11,18H2,1-2H3/b26-17- |
| InChIKey | CAOKAUAFDDHQGB-ONUIUJJFSA-N |
| XLogP | 7.70 |
| TPSA | 51.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|