C31H37N3O2S2 — CID 18806327
(5Z)-5-[[3-(3-butoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-3-(2-ethylhexyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18806327) has the molecular formula C31H37N3O2S2 and a molecular weight of 547.79 g/mol. Its IUPAC name is (5Z)-5-[[3-(3-butoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-3-(2-ethylhexyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-(3-butoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-3-(2-ethylhexyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18806327 |
| Molecular Formula | C31H37N3O2S2 |
| Molecular Weight | 547.79 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | (5Z)-5-[[3-(3-butoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-3-(2-ethylhexyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCOc1cccc(-c2nn(-c3ccccc3)cc2/C=C2\SC(=S)N(CC(CC)CCCC)C2=O)c1 |
| InChI | InChI=1S/C31H37N3O2S2/c1-4-7-13-23(6-3)21-33-30(35)28(38-31(33)37)20-25-22-34(26-15-10-9-11-16-26)32-29(25)24-14-12-17-27(19-24)36-18-8-5-2/h9-12,14-17,19-20,22-23H,4-8,13,18,21H2,1-3H3/b28-20- |
| InChIKey | KXAVNJAPWBGLFO-RRAHZORUSA-N |
| XLogP | 8.14 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.79 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|