C27H29N3OS2 — CID 2139883
(5E)-5-[(1,3-diphenylpyrazol-4-yl)methylidene]-3-[(2S)-2-ethylhexyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 2139883) has the molecular formula C27H29N3OS2 and a molecular weight of 475.68 g/mol. Its IUPAC name is (5E)-5-[(1,3-diphenylpyrazol-4-yl)methylidene]-3-[(2S)-2-ethylhexyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(1,3-diphenylpyrazol-4-yl)methylidene]-3-[(2S)-2-ethylhexyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2139883 |
| Molecular Formula | C27H29N3OS2 |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | (5E)-5-[(1,3-diphenylpyrazol-4-yl)methylidene]-3-[(2S)-2-ethylhexyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCC[C@H](CC)CN1C(=O)/C(=C\c2cn(-c3ccccc3)nc2-c2ccccc2)SC1=S |
| InChI | InChI=1S/C27H29N3OS2/c1-3-5-12-20(4-2)18-29-26(31)24(33-27(29)32)17-22-19-30(23-15-10-7-11-16-23)28-25(22)21-13-8-6-9-14-21/h6-11,13-17,19-20H,3-5,12,18H2,1-2H3/b24-17+/t20-/m0/s1 |
| InChIKey | RQAMSOGMQKNBCC-MHIQDMOBSA-N |
| XLogP | 6.96 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|