C26H27N3O2S2 — CID 4700200
3-(2-methylpropyl)-5-[[1-phenyl-3-(3-propoxyphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4700200) has the molecular formula C26H27N3O2S2 and a molecular weight of 477.66 g/mol. Its IUPAC name is 3-(2-methylpropyl)-5-[[1-phenyl-3-(3-propoxyphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(2-methylpropyl)-5-[[1-phenyl-3-(3-propoxyphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4700200 |
| Molecular Formula | C26H27N3O2S2 |
| Molecular Weight | 477.66 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 3-(2-methylpropyl)-5-[[1-phenyl-3-(3-propoxyphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCOc1cccc(-c2nn(-c3ccccc3)cc2C=C2SC(=S)N(CC(C)C)C2=O)c1 |
| InChI | InChI=1S/C26H27N3O2S2/c1-4-13-31-22-12-8-9-19(14-22)24-20(17-29(27-24)21-10-6-5-7-11-21)15-23-25(30)28(16-18(2)3)26(32)33-23/h5-12,14-15,17-18H,4,13,16H2,1-3H3 |
| InChIKey | RJXOAQYNRUJUII-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.66 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|