C27H23N3OS2 — CID 4282341
3-(2-methylpropyl)-5-[(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4282341) has the molecular formula C27H23N3OS2 and a molecular weight of 469.64 g/mol. Its IUPAC name is 3-(2-methylpropyl)-5-[(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(2-methylpropyl)-5-[(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4282341 |
| Molecular Formula | C27H23N3OS2 |
| Molecular Weight | 469.64 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 3-(2-methylpropyl)-5-[(3-naphthalen-2-yl-1-phenylpyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC(C)CN1C(=O)C(=Cc2cn(-c3ccccc3)nc2-c2ccc3ccccc3c2)SC1=S |
| InChI | InChI=1S/C27H23N3OS2/c1-18(2)16-29-26(31)24(33-27(29)32)15-22-17-30(23-10-4-3-5-11-23)28-25(22)21-13-12-19-8-6-7-9-20(19)14-21/h3-15,17-18H,16H2,1-2H3 |
| InChIKey | FCPJCWZAWGFRHC-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.64 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|