C18H23NOS2 — CID 6006001
(5Z)-5-benzylidene-3-(2-ethylhexyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6006001) has the molecular formula C18H23NOS2 and a molecular weight of 333.52 g/mol. Its IUPAC name is (5Z)-5-benzylidene-3-(2-ethylhexyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-benzylidene-3-(2-ethylhexyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6006001 |
| Molecular Formula | C18H23NOS2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (5Z)-5-benzylidene-3-(2-ethylhexyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCC(CC)CN1C(=O)/C(=C/c2ccccc2)SC1=S |
| InChI | InChI=1S/C18H23NOS2/c1-3-5-9-14(4-2)13-19-17(20)16(22-18(19)21)12-15-10-7-6-8-11-15/h6-8,10-12,14H,3-5,9,13H2,1-2H3/b16-12- |
| InChIKey | SXDTYMIQWDPEIE-VBKFSLOCSA-N |
| XLogP | 5.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|