C16H21NOS3 — CID 2132070
(5Z)-3-[(2R)-2-ethylhexyl]-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 2132070) has the molecular formula C16H21NOS3 and a molecular weight of 339.55 g/mol. Its IUPAC name is (5Z)-3-[(2R)-2-ethylhexyl]-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-[(2R)-2-ethylhexyl]-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2132070 |
| Molecular Formula | C16H21NOS3 |
| Molecular Weight | 339.55 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | (5Z)-3-[(2R)-2-ethylhexyl]-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | CCCC[C@@H](CC)CN1C(=O)/C(=C/c2cccs2)SC1=S |
| InChI | InChI=1S/C16H21NOS3/c1-3-5-7-12(4-2)11-17-15(18)14(21-16(17)19)10-13-8-6-9-20-13/h6,8-10,12H,3-5,7,11H2,1-2H3/b14-10-/t12-/m1/s1 |
| InChIKey | CEDZKZRRPVWLKH-XTCQQWIJSA-N |
| XLogP | 5.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|