C26H22N4O2S — CID 5048800
5-[[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one (PubChem CID 5048800) has the molecular formula C26H22N4O2S and a molecular weight of 454.56 g/mol. Its IUPAC name is 5-[[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one.
| Compound Name | 5-[[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 5048800 |
| Molecular Formula | C26H22N4O2S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 5-[[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCCCC2)SC1=Cc1cn(-c2ccccc2)nc1-c1cc2ccccc2o1 |
| InChI | InChI=1S/C26H22N4O2S/c31-25-23(33-26(27-25)29-13-7-2-8-14-29)16-19-17-30(20-10-3-1-4-11-20)28-24(19)22-15-18-9-5-6-12-21(18)32-22/h1,3-6,9-12,15-17H,2,7-8,13-14H2 |
| InChIKey | HEGGBEMNVQBPIJ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 63.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|