C13H10NO5S2- — CID 2183604
2-[2-methoxy-6-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate (PubChem CID 2183604) has the molecular formula C13H10NO5S2- and a molecular weight of 324.36 g/mol. Its IUPAC name is 2-[2-methoxy-6-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate.
| Compound Name | 2-[2-methoxy-6-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 2183604 |
| Molecular Formula | C13H10NO5S2- |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 2-[2-methoxy-6-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate |
| SMILES | COc1cccc(/C=C2\SC(=S)NC2=O)c1OCC(=O)[O-] |
| InChI | InChI=1S/C13H11NO5S2/c1-18-8-4-2-3-7(11(8)19-6-10(15)16)5-9-12(17)14-13(20)21-9/h2-5H,6H2,1H3,(H,15,16)(H,14,17,20)/p-1/b9-5- |
| InChIKey | WXPSMJWFXALCSG-UITAMQMPSA-M |
| XLogP | 0.31 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|