C19H16N2O6S3 — CID 2928269
[2-methoxy-6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-acetamidobenzenesulfonate (PubChem CID 2928269) has the molecular formula C19H16N2O6S3 and a molecular weight of 464.55 g/mol. Its IUPAC name is [2-methoxy-6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [2-methoxy-6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 2928269 |
| Molecular Formula | C19H16N2O6S3 |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | [2-methoxy-6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-acetamidobenzenesulfonate |
| SMILES | COc1cccc(C=C2SC(=S)NC2=O)c1OS(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C19H16N2O6S3/c1-11(22)20-13-6-8-14(9-7-13)30(24,25)27-17-12(4-3-5-15(17)26-2)10-16-18(23)21-19(28)29-16/h3-10H,1-2H3,(H,20,22)(H,21,23,28) |
| InChIKey | GZEPOWBMLBBVCS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|