C19H16ClN3O6S2 — CID 154778516
[2-chloro-4-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenyl] 4-acetamidobenzenesulfonate (PubChem CID 154778516) has the molecular formula C19H16ClN3O6S2 and a molecular weight of 481.94 g/mol. Its IUPAC name is [2-chloro-4-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [2-chloro-4-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 154778516 |
| Molecular Formula | C19H16ClN3O6S2 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.02 |
| IUPAC Name | [2-chloro-4-[(Z)-(2-imino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenyl] 4-acetamidobenzenesulfonate |
| SMILES | [H]/N=C1\NC(=O)/C(=C/c2cc(Cl)c(OS(=O)(=O)c3ccc(NC(C)=O)cc3)c(OC)c2)S1 |
| InChI | InChI=1S/C19H16ClN3O6S2/c1-10(24)22-12-3-5-13(6-4-12)31(26,27)29-17-14(20)7-11(8-15(17)28-2)9-16-18(25)23-19(21)30-16/h3-9H,1-2H3,(H,22,24)(H2,21,23,25)/b16-9- |
| InChIKey | IFALCFCWWUKOKK-SXGWCWSVSA-N |
| XLogP | 3.21 |
| TPSA | 134.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|