C22H23ClN2O5S — CID 171128911
5-[[3-chloro-5-methoxy-4-[2-[2-(2-methylphenoxy)ethoxy]ethoxy]phenyl]methylidene]-2-imino-1,3-thiazolidin-4-one (PubChem CID 171128911) has the molecular formula C22H23ClN2O5S and a molecular weight of 462.96 g/mol. Its IUPAC name is 5-[[3-chloro-5-methoxy-4-[2-[2-(2-methylphenoxy)ethoxy]ethoxy]phenyl]methylidene]-2-imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[3-chloro-5-methoxy-4-[2-[2-(2-methylphenoxy)ethoxy]ethoxy]phenyl]methylidene]-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 171128911 |
| Molecular Formula | C22H23ClN2O5S |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 5-[[3-chloro-5-methoxy-4-[2-[2-(2-methylphenoxy)ethoxy]ethoxy]phenyl]methylidene]-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\NC(=O)C(=Cc2cc(Cl)c(OCCOCCOc3ccccc3C)c(OC)c2)S1 |
| InChI | InChI=1S/C22H23ClN2O5S/c1-14-5-3-4-6-17(14)29-9-7-28-8-10-30-20-16(23)11-15(12-18(20)27-2)13-19-21(26)25-22(24)31-19/h3-6,11-13H,7-10H2,1-2H3,(H2,24,25,26) |
| InChIKey | ZDXWCITWJAHMHU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|