C20H17Cl2NO3S2 — CID 5161552
5-[[3,5-dichloro-4-[3-(2-methylphenoxy)propoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 5161552) has the molecular formula C20H17Cl2NO3S2 and a molecular weight of 454.40 g/mol. Its IUPAC name is 5-[[3,5-dichloro-4-[3-(2-methylphenoxy)propoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[3,5-dichloro-4-[3-(2-methylphenoxy)propoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5161552 |
| Molecular Formula | C20H17Cl2NO3S2 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | 5-[[3,5-dichloro-4-[3-(2-methylphenoxy)propoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccccc1OCCCOc1c(Cl)cc(C=C2SC(=S)NC2=O)cc1Cl |
| InChI | InChI=1S/C20H17Cl2NO3S2/c1-12-5-2-3-6-16(12)25-7-4-8-26-18-14(21)9-13(10-15(18)22)11-17-19(24)23-20(27)28-17/h2-3,5-6,9-11H,4,7-8H2,1H3,(H,23,24,27) |
| InChIKey | DZKBVKFPXAUCTK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|