C21H20ClNO5S2 — CID 2230636
(5Z)-5-[[3-chloro-5-methoxy-4-[3-(3-methoxyphenoxy)propoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 2230636) has the molecular formula C21H20ClNO5S2 and a molecular weight of 465.98 g/mol. Its IUPAC name is (5Z)-5-[[3-chloro-5-methoxy-4-[3-(3-methoxyphenoxy)propoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-chloro-5-methoxy-4-[3-(3-methoxyphenoxy)propoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2230636 |
| Molecular Formula | C21H20ClNO5S2 |
| Molecular Weight | 465.98 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | (5Z)-5-[[3-chloro-5-methoxy-4-[3-(3-methoxyphenoxy)propoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cccc(OCCCOc2c(Cl)cc(/C=C3\SC(=S)NC3=O)cc2OC)c1 |
| InChI | InChI=1S/C21H20ClNO5S2/c1-25-14-5-3-6-15(12-14)27-7-4-8-28-19-16(22)9-13(10-17(19)26-2)11-18-20(24)23-21(29)30-18/h3,5-6,9-12H,4,7-8H2,1-2H3,(H,23,24,29)/b18-11- |
| InChIKey | NCDCTCHQXHVGFZ-WQRHYEAKSA-N |
| XLogP | 4.69 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.98 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|