C24H27ClN2O4S — CID 171128456
5-[[4-[3-(4-tert-butylphenoxy)propoxy]-3-chloro-5-methoxyphenyl]methylidene]-2-imino-1,3-thiazolidin-4-one (PubChem CID 171128456) has the molecular formula C24H27ClN2O4S and a molecular weight of 475.01 g/mol. Its IUPAC name is 5-[[4-[3-(4-tert-butylphenoxy)propoxy]-3-chloro-5-methoxyphenyl]methylidene]-2-imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-[3-(4-tert-butylphenoxy)propoxy]-3-chloro-5-methoxyphenyl]methylidene]-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 171128456 |
| Molecular Formula | C24H27ClN2O4S |
| Molecular Weight | 475.01 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 5-[[4-[3-(4-tert-butylphenoxy)propoxy]-3-chloro-5-methoxyphenyl]methylidene]-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\NC(=O)C(=Cc2cc(Cl)c(OCCCOc3ccc(C(C)(C)C)cc3)c(OC)c2)S1 |
| InChI | InChI=1S/C24H27ClN2O4S/c1-24(2,3)16-6-8-17(9-7-16)30-10-5-11-31-21-18(25)12-15(13-19(21)29-4)14-20-22(28)27-23(26)32-20/h6-9,12-14H,5,10-11H2,1-4H3,(H2,26,27,28) |
| InChIKey | ODZBQHVOVICYJT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.01 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|