C22H23NO4S2 — CID 2907024
5-[[2-[3-(2,5-dimethylphenoxy)propoxy]-3-methoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 2907024) has the molecular formula C22H23NO4S2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 5-[[2-[3-(2,5-dimethylphenoxy)propoxy]-3-methoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[2-[3-(2,5-dimethylphenoxy)propoxy]-3-methoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2907024 |
| Molecular Formula | C22H23NO4S2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 5-[[2-[3-(2,5-dimethylphenoxy)propoxy]-3-methoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cccc(C=C2SC(=S)NC2=O)c1OCCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C22H23NO4S2/c1-14-8-9-15(2)18(12-14)26-10-5-11-27-20-16(6-4-7-17(20)25-3)13-19-21(24)23-22(28)29-19/h4,6-9,12-13H,5,10-11H2,1-3H3,(H,23,24,28) |
| InChIKey | XUKWBTKSVGTTRM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|