C19H12Cl2N4O2S — CID 10410476
N-(5,6-dichloro-1,3-benzothiazol-2-yl)-2-(4-formyl-3-phenylpyrazol-1-yl)acetamide (PubChem CID 10410476) has the molecular formula C19H12Cl2N4O2S and a molecular weight of 431.30 g/mol. Its IUPAC name is N-(5,6-dichloro-1,3-benzothiazol-2-yl)-2-(4-formyl-3-phenylpyrazol-1-yl)acetamide.
| Compound Name | N-(5,6-dichloro-1,3-benzothiazol-2-yl)-2-(4-formyl-3-phenylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 10410476 |
| Molecular Formula | C19H12Cl2N4O2S |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | N-(5,6-dichloro-1,3-benzothiazol-2-yl)-2-(4-formyl-3-phenylpyrazol-1-yl)acetamide |
| SMILES | O=Cc1cn(CC(=O)Nc2nc3cc(Cl)c(Cl)cc3s2)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H12Cl2N4O2S/c20-13-6-15-16(7-14(13)21)28-19(22-15)23-17(27)9-25-8-12(10-26)18(24-25)11-4-2-1-3-5-11/h1-8,10H,9H2,(H,22,23,27) |
| InChIKey | ZKGZWTGSGSFTQF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|