C9H8Cl2N4OS — CID 15403567
N-(5,6-dichloro-1,3-benzothiazol-2-yl)-2-hydrazinylacetamide (PubChem CID 15403567) has the molecular formula C9H8Cl2N4OS and a molecular weight of 291.16 g/mol. Its IUPAC name is N-(5,6-dichloro-1,3-benzothiazol-2-yl)-2-hydrazinylacetamide.
| Compound Name | N-(5,6-dichloro-1,3-benzothiazol-2-yl)-2-hydrazinylacetamide |
|---|---|
| PubChem CID | 15403567 |
| Molecular Formula | C9H8Cl2N4OS |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | N-(5,6-dichloro-1,3-benzothiazol-2-yl)-2-hydrazinylacetamide |
| SMILES | NNCC(=O)Nc1nc2cc(Cl)c(Cl)cc2s1 |
| InChI | InChI=1S/C9H8Cl2N4OS/c10-4-1-6-7(2-5(4)11)17-9(14-6)15-8(16)3-13-12/h1-2,13H,3,12H2,(H,14,15,16) |
| InChIKey | WHVCRIUSMYURCX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|