C12H10BrCl2N3O2S — CID 54243109
1-(2-bromoethyl)-3-(5,6-dichloro-1,3-benzothiazol-2-yl)-1-(2-oxoethyl)urea (PubChem CID 54243109) has the molecular formula C12H10BrCl2N3O2S and a molecular weight of 411.11 g/mol. Its IUPAC name is 1-(2-bromoethyl)-3-(5,6-dichloro-1,3-benzothiazol-2-yl)-1-(2-oxoethyl)urea.
| Compound Name | 1-(2-bromoethyl)-3-(5,6-dichloro-1,3-benzothiazol-2-yl)-1-(2-oxoethyl)urea |
|---|---|
| PubChem CID | 54243109 |
| Molecular Formula | C12H10BrCl2N3O2S |
| Molecular Weight | 411.11 g/mol |
| Exact Mass | 408.91 |
| IUPAC Name | 1-(2-bromoethyl)-3-(5,6-dichloro-1,3-benzothiazol-2-yl)-1-(2-oxoethyl)urea |
| SMILES | O=CCN(CCBr)C(=O)Nc1nc2cc(Cl)c(Cl)cc2s1 |
| InChI | InChI=1S/C12H10BrCl2N3O2S/c13-1-2-18(3-4-19)12(20)17-11-16-9-5-7(14)8(15)6-10(9)21-11/h4-6H,1-3H2,(H,16,17,20) |
| InChIKey | QRJULNSJMSBRIT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.11 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|