C9H3Cl2F3N2OS — CID 91742187
N-(5,6-dichloro-1,3-benzothiazol-2-yl)-2,2,2-trifluoroacetamide (PubChem CID 91742187) has the molecular formula C9H3Cl2F3N2OS and a molecular weight of 315.10 g/mol. Its IUPAC name is N-(5,6-dichloro-1,3-benzothiazol-2-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(5,6-dichloro-1,3-benzothiazol-2-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 91742187 |
| Molecular Formula | C9H3Cl2F3N2OS |
| Molecular Weight | 315.10 g/mol |
| Exact Mass | 313.93 |
| IUPAC Name | N-(5,6-dichloro-1,3-benzothiazol-2-yl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1nc2cc(Cl)c(Cl)cc2s1)C(F)(F)F |
| InChI | InChI=1S/C9H3Cl2F3N2OS/c10-3-1-5-6(2-4(3)11)18-8(15-5)16-7(17)9(12,13)14/h1-2H,(H,15,16,17) |
| InChIKey | WKYNHNRROJBZCK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.10 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |