C10H12Cl2N2SSi — CID 91740451
5,6-dichloro-N-trimethylsilyl-1,3-benzothiazol-2-amine (PubChem CID 91740451) has the molecular formula C10H12Cl2N2SSi and a molecular weight of 291.28 g/mol. Its IUPAC name is 5,6-dichloro-N-trimethylsilyl-1,3-benzothiazol-2-amine.
| Compound Name | 5,6-dichloro-N-trimethylsilyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 91740451 |
| Molecular Formula | C10H12Cl2N2SSi |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 5,6-dichloro-N-trimethylsilyl-1,3-benzothiazol-2-amine |
| SMILES | C[Si](C)(C)Nc1nc2cc(Cl)c(Cl)cc2s1 |
| InChI | InChI=1S/C10H12Cl2N2SSi/c1-16(2,3)14-10-13-8-4-6(11)7(12)5-9(8)15-10/h4-5H,1-3H3,(H,13,14) |
| InChIKey | VQAVOBSSXMRRDH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|