About 2,5-dichloro-6-methoxy-1,3-benzothiazole
2,5-dichloro-6-methoxy-1,3-benzothiazole (PubChem CID 83841308) has the molecular formula C8H5Cl2NOS
and a molecular weight of 234.11 g/mol. Its IUPAC name is 2,5-dichloro-6-methoxy-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2,5-dichloro-6-methoxy-1,3-benzothiazole |
| PubChem CID | 83841308 |
| Molecular Formula | C8H5Cl2NOS |
| Molecular Weight | 234.11 g/mol |
| Exact Mass | 232.95 |
| IUPAC Name | 2,5-dichloro-6-methoxy-1,3-benzothiazole |
| SMILES | COc1cc2sc(Cl)nc2cc1Cl |
| InChI | InChI=1S/C8H5Cl2NOS/c1-12-6-3-7-5(2-4(6)9)11-8(10)13-7/h2-3H,1H3 |
| InChIKey | VUYCPJKFLWDRFI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.11 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-dichloro-6-methoxy-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichloro-6-methoxy-1,3-benzothiazole?
The IUPAC name of 2,5-dichloro-6-methoxy-1,3-benzothiazole (CID 83841308) is 2,5-dichloro-6-methoxy-1,3-benzothiazole.
What is the SMILES notation for 2,5-dichloro-6-methoxy-1,3-benzothiazole?
The canonical SMILES for 2,5-dichloro-6-methoxy-1,3-benzothiazole is COc1cc2sc(Cl)nc2cc1Cl.
What is the InChIKey of 2,5-dichloro-6-methoxy-1,3-benzothiazole?
The InChIKey is VUYCPJKFLWDRFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Cl2NOS/c1-12-6-3-7-5(2-4(6)9)11-8(10)13-7/h2-3H,1H3.
What are the key properties of 2,5-dichloro-6-methoxy-1,3-benzothiazole?
2,5-dichloro-6-methoxy-1,3-benzothiazole has a molecular weight of 234.11 g/mol, XLogP of 3.61, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-6-methoxy-1,3-benzothiazole is sourced from PubChem (CID 83841308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).