C19H23Cl2N5OS2 — CID 139641636
N-(5,6-dichloro-1,3-benzothiazol-2-yl)-2-[2-[3-(dimethylamino)propylamino]-5-ethyl-1,3-thiazol-4-yl]acetamide (PubChem CID 139641636) has the molecular formula C19H23Cl2N5OS2 and a molecular weight of 472.47 g/mol. Its IUPAC name is N-(5,6-dichloro-1,3-benzothiazol-2-yl)-2-[2-[3-(dimethylamino)propylamino]-5-ethyl-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(5,6-dichloro-1,3-benzothiazol-2-yl)-2-[2-[3-(dimethylamino)propylamino]-5-ethyl-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 139641636 |
| Molecular Formula | C19H23Cl2N5OS2 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | N-(5,6-dichloro-1,3-benzothiazol-2-yl)-2-[2-[3-(dimethylamino)propylamino]-5-ethyl-1,3-thiazol-4-yl]acetamide |
| SMILES | CCc1sc(NCCCN(C)C)nc1CC(=O)Nc1nc2cc(Cl)c(Cl)cc2s1 |
| InChI | InChI=1S/C19H23Cl2N5OS2/c1-4-15-14(23-18(28-15)22-6-5-7-26(2)3)10-17(27)25-19-24-13-8-11(20)12(21)9-16(13)29-19/h8-9H,4-7,10H2,1-3H3,(H,22,23)(H,24,25,27) |
| InChIKey | PYPBFLWFHIVKPE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|