C29H29N3O4 — CID 26820186
(E)-3-(1-benzyl-3-phenylpyrazol-4-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]prop-2-enamide (PubChem CID 26820186) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is (E)-3-(1-benzyl-3-phenylpyrazol-4-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(1-benzyl-3-phenylpyrazol-4-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 26820186 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | (E)-3-(1-benzyl-3-phenylpyrazol-4-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]prop-2-enamide |
| SMILES | COc1cc(CNC(=O)/C=C/c2cn(Cc3ccccc3)nc2-c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C29H29N3O4/c1-34-25-16-22(17-26(35-2)29(25)36-3)18-30-27(33)15-14-24-20-32(19-21-10-6-4-7-11-21)31-28(24)23-12-8-5-9-13-23/h4-17,20H,18-19H2,1-3H3,(H,30,33)/b15-14+ |
| InChIKey | LHSWFVIQAVZMPS-CCEZHUSRSA-N |
| XLogP | 4.95 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|