C24H26N4O2 — CID 76868399
3-[3-(1-benzyl-3-phenylpyrazol-4-yl)prop-2-enoylamino]-2,2-dimethylpropanamide (PubChem CID 76868399) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 3-[3-(1-benzyl-3-phenylpyrazol-4-yl)prop-2-enoylamino]-2,2-dimethylpropanamide.
| Compound Name | 3-[3-(1-benzyl-3-phenylpyrazol-4-yl)prop-2-enoylamino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 76868399 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 3-[3-(1-benzyl-3-phenylpyrazol-4-yl)prop-2-enoylamino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CNC(=O)C=Cc1cn(Cc2ccccc2)nc1-c1ccccc1)C(N)=O |
| InChI | InChI=1S/C24H26N4O2/c1-24(2,23(25)30)17-26-21(29)14-13-20-16-28(15-18-9-5-3-6-10-18)27-22(20)19-11-7-4-8-12-19/h3-14,16H,15,17H2,1-2H3,(H2,25,30)(H,26,29) |
| InChIKey | VLWZGNDUFPAMQA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|