C11H13BrN2O2 — CID 177187823
3-bromo-1H-pyrrolo[2,3-b]pyridine-2-carbaldehyde;methoxyethane (PubChem CID 177187823) has the molecular formula C11H13BrN2O2 and a molecular weight of 285.14 g/mol. Its IUPAC name is 3-bromo-1H-pyrrolo[2,3-b]pyridine-2-carbaldehyde;methoxyethane.
| Compound Name | 3-bromo-1H-pyrrolo[2,3-b]pyridine-2-carbaldehyde;methoxyethane |
|---|---|
| PubChem CID | 177187823 |
| Molecular Formula | C11H13BrN2O2 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 3-bromo-1H-pyrrolo[2,3-b]pyridine-2-carbaldehyde;methoxyethane |
| SMILES | CCOC.O=Cc1[nH]c2ncccc2c1Br |
| InChI | InChI=1S/C8H5BrN2O.C3H8O/c9-7-5-2-1-3-10-8(5)11-6(7)4-12;1-3-4-2/h1-4H,(H,10,11);3H2,1-2H3 |
| InChIKey | TUKIIUJDFLGAND-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|