C14H21N3O — CID 175557195
2,3-di(propan-2-yl)-1H-pyrrolo[2,3-b]pyridine;formamide (PubChem CID 175557195) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 2,3-di(propan-2-yl)-1H-pyrrolo[2,3-b]pyridine;formamide.
| Compound Name | 2,3-di(propan-2-yl)-1H-pyrrolo[2,3-b]pyridine;formamide |
|---|---|
| PubChem CID | 175557195 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 2,3-di(propan-2-yl)-1H-pyrrolo[2,3-b]pyridine;formamide |
| SMILES | CC(C)c1[nH]c2ncccc2c1C(C)C.NC=O |
| InChI | InChI=1S/C13H18N2.CH3NO/c1-8(2)11-10-6-5-7-14-13(10)15-12(11)9(3)4;2-1-3/h5-9H,1-4H3,(H,14,15);1H,(H2,2,3) |
| InChIKey | GCEWLZJRKSUJCB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|