C13H14N2O — CID 84680375
2-cyclopentyl-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde (PubChem CID 84680375) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 2-cyclopentyl-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde.
| Compound Name | 2-cyclopentyl-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 84680375 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2-cyclopentyl-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde |
| SMILES | O=Cc1c(C2CCCC2)[nH]c2ncccc12 |
| InChI | InChI=1S/C13H14N2O/c16-8-11-10-6-3-7-14-13(10)15-12(11)9-4-1-2-5-9/h3,6-9H,1-2,4-5H2,(H,14,15) |
| InChIKey | PKLBDAPIOOMSMY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|