C12H12N2O2 — CID 84681730
3-cyclobutyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (PubChem CID 84681730) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 3-cyclobutyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid.
| Compound Name | 3-cyclobutyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 84681730 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 3-cyclobutyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1[nH]c2ncccc2c1C1CCC1 |
| InChI | InChI=1S/C12H12N2O2/c15-12(16)10-9(7-3-1-4-7)8-5-2-6-13-11(8)14-10/h2,5-7H,1,3-4H2,(H,13,14)(H,15,16) |
| InChIKey | WYYZSUXCCGSIHV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |