2-cyclopentylpyridine-3-carboxylic acid

C11H13NO2 — CID 83915500

IUPAC2-cyclopentylpyridine-3-carboxylic acid
SMILESO=C(O)c1cccnc1C1CCCC1
InChIInChI=1S/C11H13NO2/c13-11(14)9-6-3-7-12-10(9)8-4-1-2-5-8/h3,6-8H,1-2,4-5H2,(H,13,14)
InChIKeyFGJCPPCOALGXPY-UHFFFAOYSA-N
MW191.23 g/mol
LogP2.44
Rot. Bonds2

About 2-cyclopentylpyridine-3-carboxylic acid

2-cyclopentylpyridine-3-carboxylic acid (PubChem CID 83915500) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-cyclopentylpyridine-3-carboxylic acid.

Molecular Properties

Compound Name2-cyclopentylpyridine-3-carboxylic acid
PubChem CID83915500
Molecular FormulaC11H13NO2
Molecular Weight191.23 g/mol
Exact Mass191.09
IUPAC Name2-cyclopentylpyridine-3-carboxylic acid
SMILESO=C(O)c1cccnc1C1CCCC1
InChIInChI=1S/C11H13NO2/c13-11(14)9-6-3-7-12-10(9)8-4-1-2-5-8/h3,6-8H,1-2,4-5H2,(H,13,14)
InChIKeyFGJCPPCOALGXPY-UHFFFAOYSA-N
XLogP2.44
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.23
LogP ≤ 52.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-cyclopentylpyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[(2S)-azetidin-2-yl]pyridine-3-carboxylic acid
CID 55275995
2-(cycloheptylamino)pyridine-3-carboxylic acid
CID 43236673
2-(2-cyclopentylethylamino)pyridine-3-carboxylic acid
CID 60731921
2-cyclohexylpyridine-3-sulfonyl chloride
CID 175131598
3-(cyclohexanecarbonyl)pyridine-2-carboxylic acid
CID 23364091
2-[cyclopentyl(methyl)carbamoyl]pyridine-3-carboxylic acid
CID 63614404
2-pyrrolidin-1-ylpyridine-3-carboxylic acid
CID 2794739
2-(cyclobutanecarbonylamino)pyridine-3-carboxylic acid
CID 63654626
2-[(2-methylcyclohexyl)methylamino]pyridine-3-carboxylic acid
CID 63511863
pyridine-2,3-dicarboxylic acid
CID 1066
4-(2-cyclopropylpyridine-3-carbonyl)-1-phenylpiperazin-2-one
CID 127881306
3-chloro-2-cyclohexylquinoline-5-carboxylic acid
CID 151558493

Frequently Asked Questions

What is the IUPAC name of 2-cyclopentylpyridine-3-carboxylic acid?
The IUPAC name of 2-cyclopentylpyridine-3-carboxylic acid (CID 83915500) is 2-cyclopentylpyridine-3-carboxylic acid.
What is the SMILES notation for 2-cyclopentylpyridine-3-carboxylic acid?
The canonical SMILES for 2-cyclopentylpyridine-3-carboxylic acid is O=C(O)c1cccnc1C1CCCC1.
What is the InChIKey of 2-cyclopentylpyridine-3-carboxylic acid?
The InChIKey is FGJCPPCOALGXPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c13-11(14)9-6-3-7-12-10(9)8-4-1-2-5-8/h3,6-8H,1-2,4-5H2,(H,13,14).
What are the key properties of 2-cyclopentylpyridine-3-carboxylic acid?
2-cyclopentylpyridine-3-carboxylic acid has a molecular weight of 191.23 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentylpyridine-3-carboxylic acid is sourced from PubChem (CID 83915500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).